| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[TXT]](/icons/ball.red.gif) | README | 2009-01-29 11:20 | 6.0K | |
| ![[   ]](/icons/unknown.gif) | smc.fields | 2009-01-29 11:12 | 1.5K | |
| ![[   ]](/icons/compressed.gif) | smc100.1.map.gz | 2008-12-27 16:26 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc100.2.map.gz | 2008-12-27 16:26 | 1.9M | |
| ![[   ]](/icons/compressed.gif) | smc100.3.map.gz | 2008-12-27 16:26 | 2.1M | |
| ![[   ]](/icons/compressed.gif) | smc100.4.map.gz | 2008-12-27 16:26 | 2.0M | |
| ![[   ]](/icons/compressed.gif) | smc100.5.map.gz | 2008-12-27 16:26 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc100.6.map.gz | 2008-12-27 16:26 | 1.8M | |
| ![[   ]](/icons/compressed.gif) | smc100.7.map.gz | 2008-12-27 16:27 | 1.9M | |
| ![[   ]](/icons/compressed.gif) | smc100.8.map.gz | 2008-12-27 16:27 | 1.8M | |
| ![[   ]](/icons/compressed.gif) | smc101.1.map.gz | 2008-12-27 16:27 | 1.8M | |
| ![[   ]](/icons/compressed.gif) | smc101.2.map.gz | 2008-12-27 16:27 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc101.3.map.gz | 2008-12-27 16:27 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc101.4.map.gz | 2008-12-27 16:27 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc101.5.map.gz | 2008-12-27 16:27 | 660K | |
| ![[   ]](/icons/compressed.gif) | smc101.6.map.gz | 2008-12-27 16:27 | 921K | |
| ![[   ]](/icons/compressed.gif) | smc101.7.map.gz | 2008-12-27 16:27 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc101.8.map.gz | 2008-12-27 16:27 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc102.1.map.gz | 2008-12-27 16:27 | 771K | |
| ![[   ]](/icons/compressed.gif) | smc102.2.map.gz | 2008-12-27 16:27 | 620K | |
| ![[   ]](/icons/compressed.gif) | smc102.3.map.gz | 2008-12-27 16:27 | 468K | |
| ![[   ]](/icons/compressed.gif) | smc102.4.map.gz | 2008-12-27 16:27 | 331K | |
| ![[   ]](/icons/compressed.gif) | smc102.5.map.gz | 2008-12-27 16:27 | 216K | |
| ![[   ]](/icons/compressed.gif) | smc102.6.map.gz | 2008-12-27 16:27 | 306K | |
| ![[   ]](/icons/compressed.gif) | smc102.7.map.gz | 2008-12-27 16:27 | 408K | |
| ![[   ]](/icons/compressed.gif) | smc102.8.map.gz | 2008-12-27 16:27 | 560K | |
| ![[   ]](/icons/compressed.gif) | smc103.1.map.gz | 2008-12-27 16:27 | 578K | |
| ![[   ]](/icons/compressed.gif) | smc103.2.map.gz | 2008-12-27 16:27 | 799K | |
| ![[   ]](/icons/compressed.gif) | smc103.3.map.gz | 2008-12-27 16:27 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc103.4.map.gz | 2008-12-27 16:27 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc103.5.map.gz | 2008-12-27 16:27 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc103.6.map.gz | 2008-12-27 16:27 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc103.7.map.gz | 2008-12-27 16:27 | 829K | |
| ![[   ]](/icons/compressed.gif) | smc103.8.map.gz | 2008-12-27 16:27 | 680K | |
| ![[   ]](/icons/compressed.gif) | smc104.1.map.gz | 2008-12-27 16:27 | 316K | |
| ![[   ]](/icons/compressed.gif) | smc104.2.map.gz | 2008-12-27 16:27 | 435K | |
| ![[   ]](/icons/compressed.gif) | smc104.3.map.gz | 2008-12-27 16:27 | 528K | |
| ![[   ]](/icons/compressed.gif) | smc104.4.map.gz | 2008-12-27 16:27 | 638K | |
| ![[   ]](/icons/compressed.gif) | smc104.5.map.gz | 2008-12-27 16:27 | 687K | |
| ![[   ]](/icons/compressed.gif) | smc104.6.map.gz | 2008-12-27 16:27 | 547K | |
| ![[   ]](/icons/compressed.gif) | smc104.7.map.gz | 2008-12-27 16:27 | 413K | |
| ![[   ]](/icons/compressed.gif) | smc104.8.map.gz | 2008-12-27 16:27 | 304K | |
| ![[   ]](/icons/compressed.gif) | smc105.1.map.gz | 2008-12-27 16:28 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc105.2.map.gz | 2008-12-27 16:28 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc105.3.map.gz | 2008-12-27 16:28 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc105.4.map.gz | 2008-12-27 16:28 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc105.5.map.gz | 2008-12-27 16:28 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc105.6.map.gz | 2008-12-27 16:28 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc105.7.map.gz | 2008-12-27 16:28 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc105.8.map.gz | 2008-12-27 16:28 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc106.1.map.gz | 2008-12-27 16:28 | 905K | |
| ![[   ]](/icons/compressed.gif) | smc106.2.map.gz | 2008-12-27 16:28 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc106.3.map.gz | 2008-12-27 16:28 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc106.4.map.gz | 2008-12-27 16:28 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc106.5.map.gz | 2008-12-27 16:28 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc106.6.map.gz | 2008-12-27 16:28 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc106.7.map.gz | 2008-12-27 16:28 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc106.8.map.gz | 2008-12-27 16:28 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc107.1.map.gz | 2008-12-27 16:28 | 317K | |
| ![[   ]](/icons/compressed.gif) | smc107.2.map.gz | 2008-12-27 16:28 | 404K | |
| ![[   ]](/icons/compressed.gif) | smc107.3.map.gz | 2008-12-27 16:28 | 500K | |
| ![[   ]](/icons/compressed.gif) | smc107.4.map.gz | 2008-12-27 16:28 | 686K | |
| ![[   ]](/icons/compressed.gif) | smc107.5.map.gz | 2008-12-27 16:28 | 822K | |
| ![[   ]](/icons/compressed.gif) | smc107.6.map.gz | 2008-12-27 16:28 | 611K | |
| ![[   ]](/icons/compressed.gif) | smc107.7.map.gz | 2008-12-27 16:28 | 524K | |
| ![[   ]](/icons/compressed.gif) | smc107.8.map.gz | 2008-12-27 16:28 | 457K | |
| ![[   ]](/icons/compressed.gif) | smc108.1.map.gz | 2008-12-27 16:28 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc108.2.map.gz | 2008-12-27 16:28 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc108.3.map.gz | 2008-12-27 16:29 | 1.5M | |
| ![[   ]](/icons/compressed.gif) | smc108.4.map.gz | 2008-12-27 16:29 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc108.5.map.gz | 2008-12-27 16:29 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc108.6.map.gz | 2008-12-27 16:29 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc108.7.map.gz | 2008-12-27 16:29 | 1.6M | |
| ![[   ]](/icons/compressed.gif) | smc108.8.map.gz | 2008-12-27 16:29 | 1.9M | |
| ![[   ]](/icons/compressed.gif) | smc109.1.map.gz | 2008-12-27 16:29 | 782K | |
| ![[   ]](/icons/compressed.gif) | smc109.2.map.gz | 2008-12-27 16:29 | 612K | |
| ![[   ]](/icons/compressed.gif) | smc109.3.map.gz | 2008-12-27 16:29 | 454K | |
| ![[   ]](/icons/compressed.gif) | smc109.4.map.gz | 2008-12-27 16:29 | 290K | |
| ![[   ]](/icons/compressed.gif) | smc109.5.map.gz | 2008-12-27 16:29 | 250K | |
| ![[   ]](/icons/compressed.gif) | smc109.6.map.gz | 2008-12-27 16:29 | 364K | |
| ![[   ]](/icons/compressed.gif) | smc109.7.map.gz | 2008-12-27 16:29 | 544K | |
| ![[   ]](/icons/compressed.gif) | smc109.8.map.gz | 2008-12-27 16:29 | 723K | |
| ![[   ]](/icons/compressed.gif) | smc110.1.map.gz | 2008-12-27 16:29 | 660K | |
| ![[   ]](/icons/compressed.gif) | smc110.2.map.gz | 2008-12-27 16:29 | 834K | |
| ![[   ]](/icons/compressed.gif) | smc110.3.map.gz | 2008-12-27 16:29 | 789K | |
| ![[   ]](/icons/compressed.gif) | smc110.4.map.gz | 2008-12-27 16:29 | 773K | |
| ![[   ]](/icons/compressed.gif) | smc110.5.map.gz | 2008-12-27 16:29 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc110.6.map.gz | 2008-12-27 16:29 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc110.7.map.gz | 2008-12-27 16:29 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc110.8.map.gz | 2008-12-27 16:29 | 938K | |
| ![[   ]](/icons/compressed.gif) | smc111.1.map.gz | 2008-12-27 16:29 | 410K | |
| ![[   ]](/icons/compressed.gif) | smc111.2.map.gz | 2008-12-27 16:29 | 503K | |
| ![[   ]](/icons/compressed.gif) | smc111.3.map.gz | 2008-12-27 16:29 | 620K | |
| ![[   ]](/icons/compressed.gif) | smc111.4.map.gz | 2008-12-27 16:29 | 629K | |
| ![[   ]](/icons/compressed.gif) | smc111.5.map.gz | 2008-12-27 16:29 | 915K | |
| ![[   ]](/icons/compressed.gif) | smc111.6.map.gz | 2008-12-27 16:29 | 918K | |
| ![[   ]](/icons/compressed.gif) | smc111.7.map.gz | 2008-12-27 16:29 | 853K | |
| ![[   ]](/icons/compressed.gif) | smc111.8.map.gz | 2008-12-27 16:29 | 705K | |
| ![[   ]](/icons/compressed.gif) | smc112.1.map.gz | 2008-12-27 16:29 | 262K | |
| ![[   ]](/icons/compressed.gif) | smc112.2.map.gz | 2008-12-27 16:29 | 300K | |
| ![[   ]](/icons/compressed.gif) | smc112.3.map.gz | 2008-12-27 16:29 | 368K | |
| ![[   ]](/icons/compressed.gif) | smc112.4.map.gz | 2008-12-27 16:29 | 439K | |
| ![[   ]](/icons/compressed.gif) | smc112.5.map.gz | 2008-12-27 16:29 | 685K | |
| ![[   ]](/icons/compressed.gif) | smc112.6.map.gz | 2008-12-27 16:29 | 529K | |
| ![[   ]](/icons/compressed.gif) | smc112.7.map.gz | 2008-12-27 16:29 | 472K | |
| ![[   ]](/icons/compressed.gif) | smc112.8.map.gz | 2008-12-27 16:29 | 385K | |
| ![[   ]](/icons/compressed.gif) | smc113.1.map.gz | 2008-12-27 16:29 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc113.2.map.gz | 2008-12-27 16:29 | 959K | |
| ![[   ]](/icons/compressed.gif) | smc113.3.map.gz | 2008-12-27 16:30 | 828K | |
| ![[   ]](/icons/compressed.gif) | smc113.4.map.gz | 2008-12-27 16:30 | 685K | |
| ![[   ]](/icons/compressed.gif) | smc113.5.map.gz | 2008-12-27 16:30 | 917K | |
| ![[   ]](/icons/compressed.gif) | smc113.6.map.gz | 2008-12-27 16:30 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc113.7.map.gz | 2008-12-27 16:30 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc113.8.map.gz | 2008-12-27 16:30 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc114.1.map.gz | 2008-12-27 16:30 | 733K | |
| ![[   ]](/icons/compressed.gif) | smc114.2.map.gz | 2008-12-27 16:30 | 622K | |
| ![[   ]](/icons/compressed.gif) | smc114.3.map.gz | 2008-12-27 16:30 | 475K | |
| ![[   ]](/icons/compressed.gif) | smc114.4.map.gz | 2008-12-27 16:30 | 358K | |
| ![[   ]](/icons/compressed.gif) | smc114.5.map.gz | 2008-12-27 16:30 | 404K | |
| ![[   ]](/icons/compressed.gif) | smc114.6.map.gz | 2008-12-27 16:30 | 530K | |
| ![[   ]](/icons/compressed.gif) | smc114.7.map.gz | 2008-12-27 16:30 | 742K | |
| ![[   ]](/icons/compressed.gif) | smc114.8.map.gz | 2008-12-27 16:30 | 871K | |
| ![[   ]](/icons/compressed.gif) | smc115.1.map.gz | 2008-12-27 16:30 | 279K | |
| ![[   ]](/icons/compressed.gif) | smc115.2.map.gz | 2008-12-27 16:30 | 310K | |
| ![[   ]](/icons/compressed.gif) | smc115.3.map.gz | 2008-12-27 16:30 | 346K | |
| ![[   ]](/icons/compressed.gif) | smc115.4.map.gz | 2008-12-27 16:30 | 309K | |
| ![[   ]](/icons/compressed.gif) | smc115.5.map.gz | 2008-12-27 16:30 | 491K | |
| ![[   ]](/icons/compressed.gif) | smc115.6.map.gz | 2008-12-27 16:30 | 544K | |
| ![[   ]](/icons/compressed.gif) | smc115.7.map.gz | 2008-12-27 16:30 | 562K | |
| ![[   ]](/icons/compressed.gif) | smc115.8.map.gz | 2008-12-27 16:30 | 524K | |
| ![[   ]](/icons/compressed.gif) | smc116.1.map.gz | 2008-12-27 16:30 | 271K | |
| ![[   ]](/icons/compressed.gif) | smc116.2.map.gz | 2008-12-27 16:30 | 342K | |
| ![[   ]](/icons/compressed.gif) | smc116.3.map.gz | 2008-12-27 16:30 | 376K | |
| ![[   ]](/icons/compressed.gif) | smc116.4.map.gz | 2008-12-27 16:30 | 387K | |
| ![[   ]](/icons/compressed.gif) | smc116.5.map.gz | 2008-12-27 16:30 | 602K | |
| ![[   ]](/icons/compressed.gif) | smc116.6.map.gz | 2008-12-27 16:30 | 565K | |
| ![[   ]](/icons/compressed.gif) | smc116.7.map.gz | 2008-12-27 16:30 | 499K | |
| ![[   ]](/icons/compressed.gif) | smc116.8.map.gz | 2008-12-27 16:30 | 407K | |
| ![[   ]](/icons/compressed.gif) | smc117.1.map.gz | 2008-12-27 16:30 | 127K | |
| ![[   ]](/icons/compressed.gif) | smc117.2.map.gz | 2008-12-27 16:30 | 137K | |
| ![[   ]](/icons/compressed.gif) | smc117.3.map.gz | 2008-12-27 16:30 | 151K | |
| ![[   ]](/icons/compressed.gif) | smc117.4.map.gz | 2008-12-27 16:30 | 189K | |
| ![[   ]](/icons/compressed.gif) | smc117.5.map.gz | 2008-12-27 16:30 | 247K | |
| ![[   ]](/icons/compressed.gif) | smc117.6.map.gz | 2008-12-27 16:30 | 270K | |
| ![[   ]](/icons/compressed.gif) | smc117.7.map.gz | 2008-12-27 16:30 | 180K | |
| ![[   ]](/icons/compressed.gif) | smc117.8.map.gz | 2008-12-27 16:30 | 151K | |
| ![[   ]](/icons/compressed.gif) | smc118.1.map.gz | 2008-12-27 16:30 | 280K | |
| ![[   ]](/icons/compressed.gif) | smc118.2.map.gz | 2008-12-27 16:30 | 276K | |
| ![[   ]](/icons/compressed.gif) | smc118.3.map.gz | 2008-12-27 16:30 | 256K | |
| ![[   ]](/icons/compressed.gif) | smc118.4.map.gz | 2008-12-27 16:30 | 235K | |
| ![[   ]](/icons/compressed.gif) | smc118.5.map.gz | 2008-12-27 16:30 | 365K | |
| ![[   ]](/icons/compressed.gif) | smc118.6.map.gz | 2008-12-27 16:30 | 420K | |
| ![[   ]](/icons/compressed.gif) | smc118.7.map.gz | 2008-12-27 16:30 | 460K | |
| ![[   ]](/icons/compressed.gif) | smc118.8.map.gz | 2008-12-27 16:30 | 507K | |
| ![[   ]](/icons/compressed.gif) | smc119.1.map.gz | 2008-12-27 16:30 | 323K | |
| ![[   ]](/icons/compressed.gif) | smc119.2.map.gz | 2008-12-27 16:30 | 347K | |
| ![[   ]](/icons/compressed.gif) | smc119.3.map.gz | 2008-12-27 16:30 | 385K | |
| ![[   ]](/icons/compressed.gif) | smc119.4.map.gz | 2008-12-27 16:30 | 270K | |
| ![[   ]](/icons/compressed.gif) | smc119.5.map.gz | 2008-12-27 16:30 | 387K | |
| ![[   ]](/icons/compressed.gif) | smc119.6.map.gz | 2008-12-27 16:30 | 397K | |
| ![[   ]](/icons/compressed.gif) | smc119.7.map.gz | 2008-12-27 16:30 | 458K | |
| ![[   ]](/icons/compressed.gif) | smc119.8.map.gz | 2008-12-27 16:30 | 533K | |
| ![[   ]](/icons/compressed.gif) | smc120.1.map.gz | 2008-12-27 16:30 | 181K | |
| ![[   ]](/icons/compressed.gif) | smc120.2.map.gz | 2008-12-27 16:30 | 182K | |
| ![[   ]](/icons/compressed.gif) | smc120.3.map.gz | 2008-12-27 16:30 | 179K | |
| ![[   ]](/icons/compressed.gif) | smc120.4.map.gz | 2008-12-27 16:30 | 169K | |
| ![[   ]](/icons/compressed.gif) | smc120.5.map.gz | 2008-12-27 16:30 | 265K | |
| ![[   ]](/icons/compressed.gif) | smc120.6.map.gz | 2008-12-27 16:30 | 297K | |
| ![[   ]](/icons/compressed.gif) | smc120.7.map.gz | 2008-12-27 16:30 | 280K | |
| ![[   ]](/icons/compressed.gif) | smc120.8.map.gz | 2008-12-27 16:30 | 251K | |
| ![[   ]](/icons/compressed.gif) | smc121.1.map.gz | 2008-12-27 16:30 | 86K | |
| ![[   ]](/icons/compressed.gif) | smc121.2.map.gz | 2008-12-27 16:30 | 103K | |
| ![[   ]](/icons/compressed.gif) | smc121.3.map.gz | 2008-12-27 16:30 | 121K | |
| ![[   ]](/icons/compressed.gif) | smc121.4.map.gz | 2008-12-27 16:30 | 104K | |
| ![[   ]](/icons/compressed.gif) | smc121.5.map.gz | 2008-12-27 16:30 | 138K | |
| ![[   ]](/icons/compressed.gif) | smc121.6.map.gz | 2008-12-27 16:30 | 153K | |
| ![[   ]](/icons/compressed.gif) | smc121.7.map.gz | 2008-12-27 16:30 | 134K | |
| ![[   ]](/icons/compressed.gif) | smc121.8.map.gz | 2008-12-27 16:30 | 143K | |
| ![[   ]](/icons/compressed.gif) | smc122.1.map.gz | 2008-12-27 16:30 | 69K | |
| ![[   ]](/icons/compressed.gif) | smc122.2.map.gz | 2008-12-27 16:30 | 73K | |
| ![[   ]](/icons/compressed.gif) | smc122.3.map.gz | 2008-12-27 16:30 | 80K | |
| ![[   ]](/icons/compressed.gif) | smc122.4.map.gz | 2008-12-27 16:30 | 78K | |
| ![[   ]](/icons/compressed.gif) | smc122.5.map.gz | 2008-12-27 16:30 | 112K | |
| ![[   ]](/icons/compressed.gif) | smc122.6.map.gz | 2008-12-27 16:30 | 85K | |
| ![[   ]](/icons/compressed.gif) | smc122.7.map.gz | 2008-12-27 16:30 | 85K | |
| ![[   ]](/icons/compressed.gif) | smc122.8.map.gz | 2008-12-27 16:30 | 89K | |
| ![[   ]](/icons/compressed.gif) | smc123.1.map.gz | 2008-12-27 16:30 | 123K | |
| ![[   ]](/icons/compressed.gif) | smc123.2.map.gz | 2008-12-27 16:30 | 112K | |
| ![[   ]](/icons/compressed.gif) | smc123.3.map.gz | 2008-12-27 16:31 | 112K | |
| ![[   ]](/icons/compressed.gif) | smc123.4.map.gz | 2008-12-27 16:31 | 92K | |
| ![[   ]](/icons/compressed.gif) | smc123.5.map.gz | 2008-12-27 16:31 | 137K | |
| ![[   ]](/icons/compressed.gif) | smc123.6.map.gz | 2008-12-27 16:31 | 145K | |
| ![[   ]](/icons/compressed.gif) | smc123.7.map.gz | 2008-12-27 16:31 | 160K | |
| ![[   ]](/icons/compressed.gif) | smc123.8.map.gz | 2008-12-27 16:31 | 198K | |
| ![[   ]](/icons/compressed.gif) | smc124.1.map.gz | 2008-12-27 16:31 | 153K | |
| ![[   ]](/icons/compressed.gif) | smc124.2.map.gz | 2008-12-27 16:31 | 137K | |
| ![[   ]](/icons/compressed.gif) | smc124.3.map.gz | 2008-12-27 16:31 | 121K | |
| ![[   ]](/icons/compressed.gif) | smc124.4.map.gz | 2008-12-27 16:31 | 106K | |
| ![[   ]](/icons/compressed.gif) | smc124.5.map.gz | 2008-12-27 16:31 | 168K | |
| ![[   ]](/icons/compressed.gif) | smc124.6.map.gz | 2008-12-27 16:31 | 198K | |
| ![[   ]](/icons/compressed.gif) | smc124.7.map.gz | 2008-12-27 16:31 | 235K | |
| ![[   ]](/icons/compressed.gif) | smc124.8.map.gz | 2008-12-27 16:31 | 228K | |
| ![[   ]](/icons/compressed.gif) | smc125.1.map.gz | 2008-12-27 16:31 | 1.3M | |
| ![[   ]](/icons/compressed.gif) | smc125.2.map.gz | 2008-12-27 16:31 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc125.3.map.gz | 2008-12-27 16:31 | 2.0M | |
| ![[   ]](/icons/compressed.gif) | smc125.4.map.gz | 2008-12-27 16:31 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc125.5.map.gz | 2008-12-27 16:31 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc125.6.map.gz | 2008-12-27 16:31 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc125.7.map.gz | 2008-12-27 16:31 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc125.8.map.gz | 2008-12-27 16:31 | 1.0M | |
| ![[   ]](/icons/compressed.gif) | smc126.1.map.gz | 2008-12-27 16:31 | 1.2M | |
| ![[   ]](/icons/compressed.gif) | smc126.2.map.gz | 2008-12-27 16:31 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc126.3.map.gz | 2008-12-27 16:31 | 842K | |
| ![[   ]](/icons/compressed.gif) | smc126.4.map.gz | 2008-12-27 16:31 | 645K | |
| ![[   ]](/icons/compressed.gif) | smc126.5.map.gz | 2008-12-27 16:31 | 388K | |
| ![[   ]](/icons/compressed.gif) | smc126.6.map.gz | 2008-12-27 16:31 | 501K | |
| ![[   ]](/icons/compressed.gif) | smc126.7.map.gz | 2008-12-27 16:31 | 686K | |
| ![[   ]](/icons/compressed.gif) | smc126.8.map.gz | 2008-12-27 16:31 | 893K | |
| ![[   ]](/icons/compressed.gif) | smc127.1.map.gz | 2008-12-27 16:31 | 89K | |
| ![[   ]](/icons/compressed.gif) | smc127.2.map.gz | 2008-12-27 16:31 | 102K | |
| ![[   ]](/icons/compressed.gif) | smc127.3.map.gz | 2008-12-27 16:31 | 85K | |
| ![[   ]](/icons/compressed.gif) | smc127.4.map.gz | 2008-12-27 16:31 | 67K | |
| ![[   ]](/icons/compressed.gif) | smc127.5.map.gz | 2008-12-27 16:31 | 61K | |
| ![[   ]](/icons/compressed.gif) | smc127.6.map.gz | 2008-12-27 16:31 | 86K | |
| ![[   ]](/icons/compressed.gif) | smc127.7.map.gz | 2008-12-27 16:31 | 78K | |
| ![[   ]](/icons/compressed.gif) | smc127.8.map.gz | 2008-12-27 16:31 | 99K | |
| ![[   ]](/icons/compressed.gif) | smc128.1.map.gz | 2008-12-27 16:31 | 527K | |
| ![[   ]](/icons/compressed.gif) | smc128.2.map.gz | 2008-12-27 16:31 | 639K | |
| ![[   ]](/icons/compressed.gif) | smc128.3.map.gz | 2008-12-27 16:31 | 814K | |
| ![[   ]](/icons/compressed.gif) | smc128.4.map.gz | 2008-12-27 16:31 | 1.1M | |
| ![[   ]](/icons/compressed.gif) | smc128.5.map.gz | 2008-12-27 16:31 | 922K | |
| ![[   ]](/icons/compressed.gif) | smc128.6.map.gz | 2008-12-27 16:31 | 695K | |
| ![[   ]](/icons/compressed.gif) | smc128.7.map.gz | 2008-12-27 16:31 | 577K | |
| ![[   ]](/icons/compressed.gif) | smc128.8.map.gz | 2008-12-27 16:31 | 513K | |
| ![[   ]](/icons/compressed.gif) | smc129.1.map.gz | 2008-12-27 16:31 | 139K | |
| ![[   ]](/icons/compressed.gif) | smc129.2.map.gz | 2008-12-27 16:31 | 192K | |
| ![[   ]](/icons/compressed.gif) | smc129.3.map.gz | 2008-12-27 16:31 | 249K | |
| ![[   ]](/icons/compressed.gif) | smc129.4.map.gz | 2008-12-27 16:31 | 344K | |
| ![[   ]](/icons/compressed.gif) | smc129.5.map.gz | 2008-12-27 16:31 | 295K | |
| ![[   ]](/icons/compressed.gif) | smc129.6.map.gz | 2008-12-27 16:31 | 223K | |
| ![[   ]](/icons/compressed.gif) | smc129.7.map.gz | 2008-12-27 16:31 | 161K | |
| ![[   ]](/icons/compressed.gif) | smc129.8.map.gz | 2008-12-27 16:31 | 146K | |
| ![[   ]](/icons/compressed.gif) | smc130.1.map.gz | 2008-12-27 16:31 | 588K | |
| ![[   ]](/icons/compressed.gif) | smc130.2.map.gz | 2008-12-27 16:31 | 637K | |
| ![[   ]](/icons/compressed.gif) | smc130.3.map.gz | 2008-12-27 16:31 | 609K | |
| ![[   ]](/icons/compressed.gif) | smc130.4.map.gz | 2008-12-27 16:32 | 541K | |
| ![[   ]](/icons/compressed.gif) | smc130.5.map.gz | 2008-12-27 16:32 | 330K | |
| ![[   ]](/icons/compressed.gif) | smc130.6.map.gz | 2008-12-27 16:32 | 346K | |
| ![[   ]](/icons/compressed.gif) | smc130.7.map.gz | 2008-12-27 16:32 | 398K | |
| ![[   ]](/icons/compressed.gif) | smc130.8.map.gz | 2008-12-27 16:32 | 402K | |
| ![[   ]](/icons/compressed.gif) | smc131.1.map.gz | 2008-12-27 16:32 | 480K | |
| ![[   ]](/icons/compressed.gif) | smc131.2.map.gz | 2008-12-27 16:32 | 401K | |
| ![[   ]](/icons/compressed.gif) | smc131.3.map.gz | 2008-12-27 16:32 | 281K | |
| ![[   ]](/icons/compressed.gif) | smc131.4.map.gz | 2008-12-27 16:32 | 226K | |
| ![[   ]](/icons/compressed.gif) | smc131.5.map.gz | 2008-12-27 16:32 | 159K | |
| ![[   ]](/icons/compressed.gif) | smc131.6.map.gz | 2008-12-27 16:32 | 191K | |
| ![[   ]](/icons/compressed.gif) | smc131.7.map.gz | 2008-12-27 16:32 | 215K | |
| ![[   ]](/icons/compressed.gif) | smc131.8.map.gz | 2008-12-27 16:32 | 250K | |
| ![[   ]](/icons/compressed.gif) | smc132.1.map.gz | 2008-12-27 16:32 | 76K | |
| ![[   ]](/icons/compressed.gif) | smc132.2.map.gz | 2008-12-27 16:32 | 68K | |
| ![[   ]](/icons/compressed.gif) | smc132.3.map.gz | 2008-12-27 16:32 | 69K | |
| ![[   ]](/icons/compressed.gif) | smc132.4.map.gz | 2008-12-27 16:32 | 69K | |
| ![[   ]](/icons/compressed.gif) | smc132.5.map.gz | 2008-12-27 16:32 | 59K | |
| ![[   ]](/icons/compressed.gif) | smc132.6.map.gz | 2008-12-27 16:32 | 67K | |
| ![[   ]](/icons/compressed.gif) | smc132.7.map.gz | 2008-12-27 16:32 | 94K | |
| ![[   ]](/icons/compressed.gif) | smc132.8.map.gz | 2008-12-27 16:32 | 71K | |
| ![[   ]](/icons/compressed.gif) | smc133.1.map.gz | 2008-12-27 16:32 | 310K | |
| ![[   ]](/icons/compressed.gif) | smc133.2.map.gz | 2008-12-27 16:32 | 432K | |
| ![[   ]](/icons/compressed.gif) | smc133.3.map.gz | 2008-12-27 16:32 | 492K | |
| ![[   ]](/icons/compressed.gif) | smc133.4.map.gz | 2008-12-27 16:32 | 559K | |
| ![[   ]](/icons/compressed.gif) | smc133.5.map.gz | 2008-12-27 16:32 | 386K | |
| ![[   ]](/icons/compressed.gif) | smc133.6.map.gz | 2008-12-27 16:32 | 358K | |
| ![[   ]](/icons/compressed.gif) | smc133.7.map.gz | 2008-12-27 16:32 | 320K | |
| ![[   ]](/icons/compressed.gif) | smc133.8.map.gz | 2008-12-27 16:32 | 254K | |
| ![[   ]](/icons/compressed.gif) | smc134.1.map.gz | 2008-12-27 16:32 | 117K | |
| ![[   ]](/icons/compressed.gif) | smc134.2.map.gz | 2008-12-27 16:32 | 158K | |
| ![[   ]](/icons/compressed.gif) | smc134.3.map.gz | 2008-12-27 16:32 | 188K | |
| ![[   ]](/icons/compressed.gif) | smc134.4.map.gz | 2008-12-27 16:32 | 226K | |
| ![[   ]](/icons/compressed.gif) | smc134.5.map.gz | 2008-12-27 16:32 | 200K | |
| ![[   ]](/icons/compressed.gif) | smc134.6.map.gz | 2008-12-27 16:32 | 171K | |
| ![[   ]](/icons/compressed.gif) | smc134.7.map.gz | 2008-12-27 16:32 | 145K | |
| ![[   ]](/icons/compressed.gif) | smc134.8.map.gz | 2008-12-27 16:32 | 112K | |
| ![[   ]](/icons/compressed.gif) | smc135.1.map.gz | 2008-12-27 16:32 | 296K | |
| ![[   ]](/icons/compressed.gif) | smc135.2.map.gz | 2008-12-27 16:32 | 286K | |
| ![[   ]](/icons/compressed.gif) | smc135.3.map.gz | 2008-12-27 16:32 | 227K | |
| ![[   ]](/icons/compressed.gif) | smc135.4.map.gz | 2008-12-27 16:32 | 195K | |
| ![[   ]](/icons/compressed.gif) | smc135.5.map.gz | 2008-12-27 16:32 | 137K | |
| ![[   ]](/icons/compressed.gif) | smc135.6.map.gz | 2008-12-27 16:32 | 165K | |
| ![[   ]](/icons/compressed.gif) | smc135.7.map.gz | 2008-12-27 16:32 | 178K | |
| ![[   ]](/icons/compressed.gif) | smc135.8.map.gz | 2008-12-27 16:32 | 207K | |
| ![[   ]](/icons/compressed.gif) | smc136.1.map.gz | 2008-12-27 16:32 | 186K | |
| ![[   ]](/icons/compressed.gif) | smc136.2.map.gz | 2008-12-27 16:32 | 182K | |
| ![[   ]](/icons/compressed.gif) | smc136.3.map.gz | 2008-12-27 16:32 | 152K | |
| ![[   ]](/icons/compressed.gif) | smc136.4.map.gz | 2008-12-27 16:32 | 136K | |
| ![[   ]](/icons/compressed.gif) | smc136.5.map.gz | 2008-12-27 16:32 | 166K | |
| ![[   ]](/icons/compressed.gif) | smc136.6.map.gz | 2008-12-27 16:32 | 129K | |
| ![[   ]](/icons/compressed.gif) | smc136.7.map.gz | 2008-12-27 16:32 | 180K | |
| ![[   ]](/icons/compressed.gif) | smc136.8.map.gz | 2008-12-27 16:32 | 144K | |
| ![[   ]](/icons/compressed.gif) | smc137.1.map.gz | 2008-12-27 16:32 | 69K | |
| ![[   ]](/icons/compressed.gif) | smc137.2.map.gz | 2008-12-27 16:32 | 68K | |
| ![[   ]](/icons/compressed.gif) | smc137.3.map.gz | 2008-12-27 16:32 | 60K | |
| ![[   ]](/icons/compressed.gif) | smc137.4.map.gz | 2008-12-27 16:32 | 53K | |
| ![[   ]](/icons/compressed.gif) | smc137.5.map.gz | 2008-12-27 16:32 | 52K | |
| ![[   ]](/icons/compressed.gif) | smc137.6.map.gz | 2008-12-27 16:32 | 56K | |
| ![[   ]](/icons/compressed.gif) | smc137.7.map.gz | 2008-12-27 16:32 | 74K | |
| ![[   ]](/icons/compressed.gif) | smc137.8.map.gz | 2008-12-27 16:32 | 53K | |
| ![[   ]](/icons/compressed.gif) | smc138.1.map.gz | 2008-12-27 16:32 | 272K | |
| ![[   ]](/icons/compressed.gif) | smc138.2.map.gz | 2008-12-27 16:32 | 352K | |
| ![[   ]](/icons/compressed.gif) | smc138.3.map.gz | 2008-12-27 16:32 | 360K | |
| ![[   ]](/icons/compressed.gif) | smc138.4.map.gz | 2008-12-27 16:32 | 346K | |
| ![[   ]](/icons/compressed.gif) | smc138.5.map.gz | 2008-12-27 16:32 | 295K | |
| ![[   ]](/icons/compressed.gif) | smc138.6.map.gz | 2008-12-27 16:32 | 274K | |
| ![[   ]](/icons/compressed.gif) | smc138.7.map.gz | 2008-12-27 16:32 | 257K | |
| ![[   ]](/icons/compressed.gif) | smc138.8.map.gz | 2008-12-27 16:32 | 234K | |
| ![[   ]](/icons/compressed.gif) | smc139.1.map.gz | 2008-12-27 16:32 | 98K | |
| ![[   ]](/icons/compressed.gif) | smc139.2.map.gz | 2008-12-27 16:32 | 131K | |
| ![[   ]](/icons/compressed.gif) | smc139.3.map.gz | 2008-12-27 16:32 | 161K | |
| ![[   ]](/icons/compressed.gif) | smc139.4.map.gz | 2008-12-27 16:32 | 180K | |
| ![[   ]](/icons/compressed.gif) | smc139.5.map.gz | 2008-12-27 16:32 | 148K | |
| ![[   ]](/icons/compressed.gif) | smc139.6.map.gz | 2008-12-27 16:32 | 137K | |
| ![[   ]](/icons/compressed.gif) | smc139.7.map.gz | 2008-12-27 16:32 | 105K | |
| ![[   ]](/icons/compressed.gif) | smc139.8.map.gz | 2008-12-27 16:32 | 93K | |
| ![[   ]](/icons/compressed.gif) | smc140.1.map.gz | 2008-12-27 16:32 | 470K | |
| ![[   ]](/icons/compressed.gif) | smc140.2.map.gz | 2008-12-27 16:32 | 1.7M | |
| ![[   ]](/icons/compressed.gif) | smc140.3.map.gz | 2008-12-27 16:32 | 1.9M | |
| ![[   ]](/icons/compressed.gif) | smc140.4.map.gz | 2008-12-27 16:32 | 552K | |
| ![[   ]](/icons/compressed.gif) | smc140.5.map.gz | 2008-12-27 16:32 | 446K | |
| ![[   ]](/icons/compressed.gif) | smc140.6.map.gz | 2008-12-27 16:32 | 1.8M | |
| ![[   ]](/icons/compressed.gif) | smc140.7.map.gz | 2008-12-27 16:32 | 1.9M | |
| ![[   ]](/icons/compressed.gif) | smc140.8.map.gz | 2008-12-27 16:32 | 573K | |
This directory contains OGLE-III maps of the Small Magellanic Cloud
fields observed during the OGLE-III phase of the OGLE survey. 
The directory structure is as follows:
README                 - this file
smc100.1.map.gz         - data for subfield SMC100.1
smc100.2.map.gz         - data for subfield SMC100.2
smc100.3.map.gz         - data for subfield SMC100.3
smc100.4.map.gz         - data for subfield SMC100.4
smc100.5.map.gz         - data for subfield SMC100.5
smc100.6.map.gz         - data for subfield SMC100.6
smc100.7.map.gz         - data for subfield SMC100.7
smc100.8.map.gz         - data for subfield SMC100.8
smc101.1.map.gz         - data for subfield SMC101.1
smc101.2.map.gz         - data for subfield SMC101.2
...
...
smc140.1.map.gz         - data for subfield SMC140.1
smc140.2.map.gz         - data for subfield SMC140.2
smc140.3.map.gz         - data for subfield SMC140.3
smc140.4.map.gz         - data for subfield SMC140.4
smc140.5.map.gz         - data for subfield SMC140.5
smc140.6.map.gz         - data for subfield SMC140.6
smc140.7.map.gz         - data for subfield SMC140.7
smc140.8.map.gz         - data for subfield SMC140.8
smc100.I.1.fts.gz      - I-band reference image of the subfield SMC100.1 (2180x4176)
smc100.I.2.fts.gz      - I-band reference image of the subfield SMC100.2 (2180x4176)
smc100.I.3.fts.gz      - I-band reference image of the subfield SMC100.3 (2180x4176)
smc100.I.4.fts.gz      - I-band reference image of the subfield SMC100.4 (2180x4176)
smc100.I.5.fts.gz      - I-band reference image of the subfield SMC100.5 (2180x4176)
smc100.I.6.fts.gz      - I-band reference image of the subfield SMC100.6 (2180x4176)
smc100.I.7.fts.gz      - I-band reference image of the subfield SMC100.7 (2180x4176)
smc100.I.8.fts.gz      - I-band reference image of the subfield SMC100.8 (2180x4176)
smc101.I.1.fts.gz      - I-band reference image of the subfield SMC101.1 (2180x4176)
smc101.I.2.fts.gz      - I-band reference image of the subfield SMC101.2 (2180x4176)
...
...
smc140.I.1.fts.gz      - I-band reference image of the subfield SMC140.1 (2180x4176)
smc140.I.2.fts.gz      - I-band reference image of the subfield SMC140.2 (2180x4176)
smc140.I.3.fts.gz      - I-band reference image of the subfield SMC140.3 (2180x4176)
smc140.I.4.fts.gz      - I-band reference image of the subfield SMC140.4 (2180x4176)
smc140.I.5.fts.gz      - I-band reference image of the subfield SMC140.5 (2180x4176)
smc140.I.6.fts.gz      - I-band reference image of the subfield SMC140.6 (2180x4176)
smc140.I.7.fts.gz      - I-band reference image of the subfield SMC140.7 (2180x4176)
smc140.I.8.fts.gz      - I-band reference image of the subfield SMC140.8 (2180x4176)
smc.fields             - coordinates of the OGLE-III SMC fields.
pap.ps.gz              - Postscript version of the paper Udalski et al (2008),
                         Acta Astron. 58, 329, describing the maps.
All *.gz files are compressed with the gzip program.
Format of maps in C-language is:
"%6d %10s %11s %7.2f %7.2f %6.3f %6.3f %6.3f %3d %2d %5.3f %4d %2d %5.3f\n"
 
with columns:
                                                                        V-band       I-band
DB_no    RA(J2000)  DEC(J2000)   X_ref  Y_ref    V      V-I     I     Ng Nb  sig   Ng Nb  sig
where
DB_no - number in the database,
RA, DEC - equatorial coordinates,
X_ref,Y_ref - pixel coordinates in the I-band reference image,
V, V-I, I - photometry data,
Ng - number of "good" measurements,
Nb - number of "bad" (removed with 5 sigma rejection alghoritm) measurements,
sig - standard deviation of "good" measurements.
Here is a sample of data from the SMC100.1 subfield map:
     1  0:50:20.07 -73:26:12.4  111.80  248.72 15.604  1.417 14.187  79 -1 0.009  632  0 0.007
     2  0:50:20.75 -73:26:16.5   96.03  259.84 15.439  9.999 99.999  84 -1 0.162    0  0 9.999
     3  0:50:22.88 -73:22:49.7  890.62  296.56 16.405  2.562 13.843  43  0 0.103  632  0 0.132
     4  0:50:24.11 -73:23:26.0  751.11  316.56 15.198  1.428 13.771  43  0 0.008  632  0 0.006
     5  0:50:25.52 -73:25:02.9  378.77  338.82 14.661  0.516 14.146  43  0 0.004  632  0 0.005
     6  0:50:43.65 -73:23:26.7  747.78  638.00 15.826  1.472 14.355  43  0 0.011  631  1 0.006
     7  0:50:45.55 -73:24:20.2  542.06  668.58 14.393  1.493 12.900  43  0 0.012  631  1 0.012
     8  0:50:48.59 -73:24:59.5  390.82  717.94 15.257  0.970 14.287  43  0 0.007  619 13 0.009
     9  0:50:50.04 -73:23:39.6  698.01  743.08 13.543  0.281 13.262  43  0 0.004  632  0 0.006
    10  0:50:06.50 -73:22:27.5  976.42   26.98 16.395  1.184 15.210  23  0 0.008  482  0 0.010
    11  0:50:10.41 -73:22:53.4  876.76   91.34 16.295  1.206 15.089  42  0 0.007  629  0 0.006
    12  0:50:12.78 -73:26:06.9  132.90  129.05 17.680  3.186 14.494  74 -1 0.309  632  0 0.156
    13  0:50:12.61 -73:22:17.5 1014.63  127.74 16.908  1.712 15.196  43  0 0.022  632  0 0.014
    14  0:50:15.59 -73:25:58.8  164.01  175.25 14.503 -0.017 14.520  77 -1 0.017  632  0 0.007
    15  0:50:17.28 -73:25:07.5  361.46  203.35 14.918 -0.096 15.014  43  0 0.006  632  0 0.006
    16  0:50:19.51 -73:23:16.0  789.87  240.95 16.655  1.377 15.278  43  0 0.009  632  0 0.006
    17  0:50:21.71 -73:22:30.3  965.12  277.45 14.704 -0.087 14.791  43  0 0.004  632  0 0.006
    18  0:50:24.06 -73:22:24.7  986.65  316.33 16.193  1.300 14.893  43  0 0.011  632  0 0.006
    19  0:50:24.31 -73:25:47.3  208.37  318.50 15.129  0.127 15.002  43  0 0.027  632  0 0.026
    20  0:50:29.20 -73:23:44.2  681.29  400.13 16.880  1.611 15.269  43  0 0.019  632  0 0.013
    21  0:50:33.25 -73:23:22.4  764.79  467.07 15.713  0.618 15.094  43  0 0.066  632  0 0.034
    22  0:50:36.24 -73:26:17.8   90.33  514.02 15.995  1.286 14.709  84 -1 0.011  627  0 0.006
WARNING!!! "Magic" numbers: 99.999 for magnitude and 9.999 for color and
standard deviation denote "no measurement". -1 in the N_b V-band column
indicates that the V-band counterpart of an object was found in more
than one subfield and the photometry was merged.
!!! Any presentation of the scientific analysis or usage of the data from
the OGLE-III VI maps of the SMC should cite the apropriate OGLE paper(s). !!!